C21H24FNO3 — CID 120546910
4-[3-(4-fluorophenyl)butanoylamino]-5-phenylpentanoic acid (PubChem CID 120546910) has the molecular formula C21H24FNO3 and a molecular weight of 357.43 g/mol. Its IUPAC name is 4-[3-(4-fluorophenyl)butanoylamino]-5-phenylpentanoic acid.
| Compound Name | 4-[3-(4-fluorophenyl)butanoylamino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 120546910 |
| Molecular Formula | C21H24FNO3 |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 4-[3-(4-fluorophenyl)butanoylamino]-5-phenylpentanoic acid |
| SMILES | CC(CC(=O)NC(CCC(=O)O)Cc1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H24FNO3/c1-15(17-7-9-18(22)10-8-17)13-20(24)23-19(11-12-21(25)26)14-16-5-3-2-4-6-16/h2-10,15,19H,11-14H2,1H3,(H,23,24)(H,25,26) |
| InChIKey | MLRVCIOFNBWDKJ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |