C16H24N2O3S — CID 122002828
4-(3-methylsulfanylpropylcarbamoylamino)-5-phenylpentanoic acid (PubChem CID 122002828) has the molecular formula C16H24N2O3S and a molecular weight of 324.45 g/mol. Its IUPAC name is 4-(3-methylsulfanylpropylcarbamoylamino)-5-phenylpentanoic acid.
| Compound Name | 4-(3-methylsulfanylpropylcarbamoylamino)-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 122002828 |
| Molecular Formula | C16H24N2O3S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 4-(3-methylsulfanylpropylcarbamoylamino)-5-phenylpentanoic acid |
| SMILES | CSCCCNC(=O)NC(CCC(=O)O)Cc1ccccc1 |
| InChI | InChI=1S/C16H24N2O3S/c1-22-11-5-10-17-16(21)18-14(8-9-15(19)20)12-13-6-3-2-4-7-13/h2-4,6-7,14H,5,8-12H2,1H3,(H,19,20)(H2,17,18,21) |
| InChIKey | XPDWGEGOQJPRJT-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|