C20H31N3O3 — CID 122001001
4-[2-[cyclopentyl(methyl)amino]ethylcarbamoylamino]-5-phenylpentanoic acid (PubChem CID 122001001) has the molecular formula C20H31N3O3 and a molecular weight of 361.49 g/mol. Its IUPAC name is 4-[2-[cyclopentyl(methyl)amino]ethylcarbamoylamino]-5-phenylpentanoic acid.
| Compound Name | 4-[2-[cyclopentyl(methyl)amino]ethylcarbamoylamino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 122001001 |
| Molecular Formula | C20H31N3O3 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | 4-[2-[cyclopentyl(methyl)amino]ethylcarbamoylamino]-5-phenylpentanoic acid |
| SMILES | CN(CCNC(=O)NC(CCC(=O)O)Cc1ccccc1)C1CCCC1 |
| InChI | InChI=1S/C20H31N3O3/c1-23(18-9-5-6-10-18)14-13-21-20(26)22-17(11-12-19(24)25)15-16-7-3-2-4-8-16/h2-4,7-8,17-18H,5-6,9-15H2,1H3,(H,24,25)(H2,21,22,26) |
| InChIKey | WOGJSWLSEUJLMO-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |