C14H22N2O2S — CID 111434483
1-(2-hydroxy-3-phenylpropyl)-3-(3-methylsulfanylpropyl)urea (PubChem CID 111434483) has the molecular formula C14H22N2O2S and a molecular weight of 282.41 g/mol. Its IUPAC name is 1-(2-hydroxy-3-phenylpropyl)-3-(3-methylsulfanylpropyl)urea.
| Compound Name | 1-(2-hydroxy-3-phenylpropyl)-3-(3-methylsulfanylpropyl)urea |
|---|---|
| PubChem CID | 111434483 |
| Molecular Formula | C14H22N2O2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 1-(2-hydroxy-3-phenylpropyl)-3-(3-methylsulfanylpropyl)urea |
| SMILES | CSCCCNC(=O)NCC(O)Cc1ccccc1 |
| InChI | InChI=1S/C14H22N2O2S/c1-19-9-5-8-15-14(18)16-11-13(17)10-12-6-3-2-4-7-12/h2-4,6-7,13,17H,5,8-11H2,1H3,(H2,15,16,18) |
| InChIKey | IWXOFCNELWVXDG-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|