C14H17N3O3 — CID 111603989
1-(2-hydroxy-3-phenylpropyl)-3-(1,2-oxazol-3-ylmethyl)urea (PubChem CID 111603989) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 1-(2-hydroxy-3-phenylpropyl)-3-(1,2-oxazol-3-ylmethyl)urea.
| Compound Name | 1-(2-hydroxy-3-phenylpropyl)-3-(1,2-oxazol-3-ylmethyl)urea |
|---|---|
| PubChem CID | 111603989 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 1-(2-hydroxy-3-phenylpropyl)-3-(1,2-oxazol-3-ylmethyl)urea |
| SMILES | O=C(NCc1ccon1)NCC(O)Cc1ccccc1 |
| InChI | InChI=1S/C14H17N3O3/c18-13(8-11-4-2-1-3-5-11)10-16-14(19)15-9-12-6-7-20-17-12/h1-7,13,18H,8-10H2,(H2,15,16,19) |
| InChIKey | OUAHNVWQORYVPN-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |