C10H15N3O4 — CID 81177239
2-[(1,2-oxazol-3-ylmethylcarbamoylamino)methyl]butanoic acid (PubChem CID 81177239) has the molecular formula C10H15N3O4 and a molecular weight of 241.25 g/mol. Its IUPAC name is 2-[(1,2-oxazol-3-ylmethylcarbamoylamino)methyl]butanoic acid.
| Compound Name | 2-[(1,2-oxazol-3-ylmethylcarbamoylamino)methyl]butanoic acid |
|---|---|
| PubChem CID | 81177239 |
| Molecular Formula | C10H15N3O4 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 2-[(1,2-oxazol-3-ylmethylcarbamoylamino)methyl]butanoic acid |
| SMILES | CCC(CNC(=O)NCc1ccon1)C(=O)O |
| InChI | InChI=1S/C10H15N3O4/c1-2-7(9(14)15)5-11-10(16)12-6-8-3-4-17-13-8/h3-4,7H,2,5-6H2,1H3,(H,14,15)(H2,11,12,16) |
| InChIKey | RRDHKLBYKQJZIP-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |