2-[(1,2-oxazol-3-ylmethylcarbamoylamino)methyl]butanoic acid

C10H15N3O4 — CID 81177239

IUPAC2-[(1,2-oxazol-3-ylmethylcarbamoylamino)methyl]butanoic acid
SMILESCCC(CNC(=O)NCc1ccon1)C(=O)O
InChIInChI=1S/C10H15N3O4/c1-2-7(9(14)15)5-11-10(16)12-6-8-3-4-17-13-8/h3-4,7H,2,5-6H2,1H3,(H,14,15)(H2,11,12,16)
InChIKeyRRDHKLBYKQJZIP-UHFFFAOYSA-N
MW241.25 g/mol
LogP0.58
Rot. Bonds6

About 2-[(1,2-oxazol-3-ylmethylcarbamoylamino)methyl]butanoic acid

2-[(1,2-oxazol-3-ylmethylcarbamoylamino)methyl]butanoic acid (PubChem CID 81177239) has the molecular formula C10H15N3O4 and a molecular weight of 241.25 g/mol. Its IUPAC name is 2-[(1,2-oxazol-3-ylmethylcarbamoylamino)methyl]butanoic acid.

Molecular Properties

Compound Name2-[(1,2-oxazol-3-ylmethylcarbamoylamino)methyl]butanoic acid
PubChem CID81177239
Molecular FormulaC10H15N3O4
Molecular Weight241.25 g/mol
Exact Mass241.11
IUPAC Name2-[(1,2-oxazol-3-ylmethylcarbamoylamino)methyl]butanoic acid
SMILESCCC(CNC(=O)NCc1ccon1)C(=O)O
InChIInChI=1S/C10H15N3O4/c1-2-7(9(14)15)5-11-10(16)12-6-8-3-4-17-13-8/h3-4,7H,2,5-6H2,1H3,(H,14,15)(H2,11,12,16)
InChIKeyRRDHKLBYKQJZIP-UHFFFAOYSA-N
XLogP0.58
TPSA104.46 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500241.25
LogP ≤ 50.58
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 2-[(1,2-oxazol-3-ylmethylcarbamoylamino)methyl]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(1,2-oxazol-3-ylmethylcarbamoylamino)methyl]butanoic acid?
The IUPAC name of 2-[(1,2-oxazol-3-ylmethylcarbamoylamino)methyl]butanoic acid (CID 81177239) is 2-[(1,2-oxazol-3-ylmethylcarbamoylamino)methyl]butanoic acid.
What is the SMILES notation for 2-[(1,2-oxazol-3-ylmethylcarbamoylamino)methyl]butanoic acid?
The canonical SMILES for 2-[(1,2-oxazol-3-ylmethylcarbamoylamino)methyl]butanoic acid is CCC(CNC(=O)NCc1ccon1)C(=O)O.
What is the InChIKey of 2-[(1,2-oxazol-3-ylmethylcarbamoylamino)methyl]butanoic acid?
The InChIKey is RRDHKLBYKQJZIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O4/c1-2-7(9(14)15)5-11-10(16)12-6-8-3-4-17-13-8/h3-4,7H,2,5-6H2,1H3,(H,14,15)(H2,11,12,16).
What are the key properties of 2-[(1,2-oxazol-3-ylmethylcarbamoylamino)methyl]butanoic acid?
2-[(1,2-oxazol-3-ylmethylcarbamoylamino)methyl]butanoic acid has a molecular weight of 241.25 g/mol, XLogP of 0.58, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1,2-oxazol-3-ylmethylcarbamoylamino)methyl]butanoic acid is sourced from PubChem (CID 81177239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).