C5H8N4O2 — CID 81177768
1-amino-3-(1,2-oxazol-3-ylmethyl)urea (PubChem CID 81177768) has the molecular formula C5H8N4O2 and a molecular weight of 156.15 g/mol. Its IUPAC name is 1-amino-3-(1,2-oxazol-3-ylmethyl)urea.
| Compound Name | 1-amino-3-(1,2-oxazol-3-ylmethyl)urea |
|---|---|
| PubChem CID | 81177768 |
| Molecular Formula | C5H8N4O2 |
| Molecular Weight | 156.15 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | 1-amino-3-(1,2-oxazol-3-ylmethyl)urea |
| SMILES | NNC(=O)NCc1ccon1 |
| InChI | InChI=1S/C5H8N4O2/c6-8-5(10)7-3-4-1-2-11-9-4/h1-2H,3,6H2,(H2,7,8,10) |
| InChIKey | HCNBWECULXDYDY-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 93.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.15 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|