C7H11N3O2 — CID 81171210
2-(methylamino)-N-(1,2-oxazol-3-ylmethyl)acetamide (PubChem CID 81171210) has the molecular formula C7H11N3O2 and a molecular weight of 169.18 g/mol. Its IUPAC name is 2-(methylamino)-N-(1,2-oxazol-3-ylmethyl)acetamide.
| Compound Name | 2-(methylamino)-N-(1,2-oxazol-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 81171210 |
| Molecular Formula | C7H11N3O2 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 2-(methylamino)-N-(1,2-oxazol-3-ylmethyl)acetamide |
| SMILES | CNCC(=O)NCc1ccon1 |
| InChI | InChI=1S/C7H11N3O2/c1-8-5-7(11)9-4-6-2-3-12-10-6/h2-3,8H,4-5H2,1H3,(H,9,11) |
| InChIKey | ANDAYYDQCAHHCJ-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |