C9H12N4O2 — CID 81177679
N-(2-cyanoethyl)-2-(1,2-oxazol-3-ylmethylamino)acetamide (PubChem CID 81177679) has the molecular formula C9H12N4O2 and a molecular weight of 208.22 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-(1,2-oxazol-3-ylmethylamino)acetamide.
| Compound Name | N-(2-cyanoethyl)-2-(1,2-oxazol-3-ylmethylamino)acetamide |
|---|---|
| PubChem CID | 81177679 |
| Molecular Formula | C9H12N4O2 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | N-(2-cyanoethyl)-2-(1,2-oxazol-3-ylmethylamino)acetamide |
| SMILES | N#CCCNC(=O)CNCc1ccon1 |
| InChI | InChI=1S/C9H12N4O2/c10-3-1-4-12-9(14)7-11-6-8-2-5-15-13-8/h2,5,11H,1,4,6-7H2,(H,12,14) |
| InChIKey | DXTHBCCNIGSCDT-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|