C7H9N5O2 — CID 106399263
N-(cyanomethyl)-2-(1,2,4-oxadiazol-3-ylmethylamino)acetamide (PubChem CID 106399263) has the molecular formula C7H9N5O2 and a molecular weight of 195.18 g/mol. Its IUPAC name is N-(cyanomethyl)-2-(1,2,4-oxadiazol-3-ylmethylamino)acetamide.
| Compound Name | N-(cyanomethyl)-2-(1,2,4-oxadiazol-3-ylmethylamino)acetamide |
|---|---|
| PubChem CID | 106399263 |
| Molecular Formula | C7H9N5O2 |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | N-(cyanomethyl)-2-(1,2,4-oxadiazol-3-ylmethylamino)acetamide |
| SMILES | N#CCNC(=O)CNCc1ncon1 |
| InChI | InChI=1S/C7H9N5O2/c8-1-2-10-7(13)4-9-3-6-11-5-14-12-6/h5,9H,2-4H2,(H,10,13) |
| InChIKey | FVYIQGPZVSDVHK-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 103.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|