C6H8ClN3O2 — CID 106395491
3-chloro-N-(1,2,4-oxadiazol-3-ylmethyl)propanamide (PubChem CID 106395491) has the molecular formula C6H8ClN3O2 and a molecular weight of 189.60 g/mol. Its IUPAC name is 3-chloro-N-(1,2,4-oxadiazol-3-ylmethyl)propanamide.
| Compound Name | 3-chloro-N-(1,2,4-oxadiazol-3-ylmethyl)propanamide |
|---|---|
| PubChem CID | 106395491 |
| Molecular Formula | C6H8ClN3O2 |
| Molecular Weight | 189.60 g/mol |
| Exact Mass | 189.03 |
| IUPAC Name | 3-chloro-N-(1,2,4-oxadiazol-3-ylmethyl)propanamide |
| SMILES | O=C(CCCl)NCc1ncon1 |
| InChI | InChI=1S/C6H8ClN3O2/c7-2-1-6(11)8-3-5-9-4-12-10-5/h4H,1-3H2,(H,8,11) |
| InChIKey | NLLOCXBRBJFRIB-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.60 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|