2-(1,2,4-oxadiazol-3-ylmethylamino)-2-oxoacetic acid

C5H5N3O4 — CID 106406078

IUPAC2-(1,2,4-oxadiazol-3-ylmethylamino)-2-oxoacetic acid
SMILESO=C(O)C(=O)NCc1ncon1
InChIInChI=1S/C5H5N3O4/c9-4(5(10)11)6-1-3-7-2-12-8-3/h2H,1H2,(H,6,9)(H,10,11)
InChIKeyNDZSLGMHZFJNQW-UHFFFAOYSA-N
MW171.11 g/mol
LogP-1.23
Rot. Bonds2

About 2-(1,2,4-oxadiazol-3-ylmethylamino)-2-oxoacetic acid

2-(1,2,4-oxadiazol-3-ylmethylamino)-2-oxoacetic acid (PubChem CID 106406078) has the molecular formula C5H5N3O4 and a molecular weight of 171.11 g/mol. Its IUPAC name is 2-(1,2,4-oxadiazol-3-ylmethylamino)-2-oxoacetic acid.

Molecular Properties

Compound Name2-(1,2,4-oxadiazol-3-ylmethylamino)-2-oxoacetic acid
PubChem CID106406078
Molecular FormulaC5H5N3O4
Molecular Weight171.11 g/mol
Exact Mass171.03
IUPAC Name2-(1,2,4-oxadiazol-3-ylmethylamino)-2-oxoacetic acid
SMILESO=C(O)C(=O)NCc1ncon1
InChIInChI=1S/C5H5N3O4/c9-4(5(10)11)6-1-3-7-2-12-8-3/h2H,1H2,(H,6,9)(H,10,11)
InChIKeyNDZSLGMHZFJNQW-UHFFFAOYSA-N
XLogP-1.23
TPSA105.32 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500171.11
LogP ≤ 5-1.23
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze 2-(1,2,4-oxadiazol-3-ylmethylamino)-2-oxoacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,2,4-oxadiazol-3-ylmethylamino)-2-oxoacetic acid?
The IUPAC name of 2-(1,2,4-oxadiazol-3-ylmethylamino)-2-oxoacetic acid (CID 106406078) is 2-(1,2,4-oxadiazol-3-ylmethylamino)-2-oxoacetic acid.
What is the SMILES notation for 2-(1,2,4-oxadiazol-3-ylmethylamino)-2-oxoacetic acid?
The canonical SMILES for 2-(1,2,4-oxadiazol-3-ylmethylamino)-2-oxoacetic acid is O=C(O)C(=O)NCc1ncon1.
What is the InChIKey of 2-(1,2,4-oxadiazol-3-ylmethylamino)-2-oxoacetic acid?
The InChIKey is NDZSLGMHZFJNQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N3O4/c9-4(5(10)11)6-1-3-7-2-12-8-3/h2H,1H2,(H,6,9)(H,10,11).
What are the key properties of 2-(1,2,4-oxadiazol-3-ylmethylamino)-2-oxoacetic acid?
2-(1,2,4-oxadiazol-3-ylmethylamino)-2-oxoacetic acid has a molecular weight of 171.11 g/mol, XLogP of -1.23, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2,4-oxadiazol-3-ylmethylamino)-2-oxoacetic acid is sourced from PubChem (CID 106406078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).