C5H5N3O4 — CID 106406078
2-(1,2,4-oxadiazol-3-ylmethylamino)-2-oxoacetic acid (PubChem CID 106406078) has the molecular formula C5H5N3O4 and a molecular weight of 171.11 g/mol. Its IUPAC name is 2-(1,2,4-oxadiazol-3-ylmethylamino)-2-oxoacetic acid.
| Compound Name | 2-(1,2,4-oxadiazol-3-ylmethylamino)-2-oxoacetic acid |
|---|---|
| PubChem CID | 106406078 |
| Molecular Formula | C5H5N3O4 |
| Molecular Weight | 171.11 g/mol |
| Exact Mass | 171.03 |
| IUPAC Name | 2-(1,2,4-oxadiazol-3-ylmethylamino)-2-oxoacetic acid |
| SMILES | O=C(O)C(=O)NCc1ncon1 |
| InChI | InChI=1S/C5H5N3O4/c9-4(5(10)11)6-1-3-7-2-12-8-3/h2H,1H2,(H,6,9)(H,10,11) |
| InChIKey | NDZSLGMHZFJNQW-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.11 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|