C11H12N4O2 — CID 103670811
1-benzyl-3-(1,2,4-oxadiazol-3-ylmethyl)urea (PubChem CID 103670811) has the molecular formula C11H12N4O2 and a molecular weight of 232.24 g/mol. Its IUPAC name is 1-benzyl-3-(1,2,4-oxadiazol-3-ylmethyl)urea.
| Compound Name | 1-benzyl-3-(1,2,4-oxadiazol-3-ylmethyl)urea |
|---|---|
| PubChem CID | 103670811 |
| Molecular Formula | C11H12N4O2 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 1-benzyl-3-(1,2,4-oxadiazol-3-ylmethyl)urea |
| SMILES | O=C(NCc1ccccc1)NCc1ncon1 |
| InChI | InChI=1S/C11H12N4O2/c16-11(13-7-10-14-8-17-15-10)12-6-9-4-2-1-3-5-9/h1-5,8H,6-7H2,(H2,12,13,16) |
| InChIKey | KQJSRHHOONZOCC-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |