C8H12N4O5 — CID 106403554
2-[2-(1,2,4-oxadiazol-3-ylmethylcarbamoylamino)ethoxy]acetic acid (PubChem CID 106403554) has the molecular formula C8H12N4O5 and a molecular weight of 244.21 g/mol. Its IUPAC name is 2-[2-(1,2,4-oxadiazol-3-ylmethylcarbamoylamino)ethoxy]acetic acid.
| Compound Name | 2-[2-(1,2,4-oxadiazol-3-ylmethylcarbamoylamino)ethoxy]acetic acid |
|---|---|
| PubChem CID | 106403554 |
| Molecular Formula | C8H12N4O5 |
| Molecular Weight | 244.21 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 2-[2-(1,2,4-oxadiazol-3-ylmethylcarbamoylamino)ethoxy]acetic acid |
| SMILES | O=C(O)COCCNC(=O)NCc1ncon1 |
| InChI | InChI=1S/C8H12N4O5/c13-7(14)4-16-2-1-9-8(15)10-3-6-11-5-17-12-6/h5H,1-4H2,(H,13,14)(H2,9,10,15) |
| InChIKey | LXSCHEDDDCPPIG-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 126.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.21 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|