C9H16N4O3 — CID 106399027
N-(2-methoxyethyl)-2-(1,2,4-oxadiazol-3-ylmethylamino)propanamide (PubChem CID 106399027) has the molecular formula C9H16N4O3 and a molecular weight of 228.25 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-(1,2,4-oxadiazol-3-ylmethylamino)propanamide.
| Compound Name | N-(2-methoxyethyl)-2-(1,2,4-oxadiazol-3-ylmethylamino)propanamide |
|---|---|
| PubChem CID | 106399027 |
| Molecular Formula | C9H16N4O3 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | N-(2-methoxyethyl)-2-(1,2,4-oxadiazol-3-ylmethylamino)propanamide |
| SMILES | COCCNC(=O)C(C)NCc1ncon1 |
| InChI | InChI=1S/C9H16N4O3/c1-7(9(14)10-3-4-15-2)11-5-8-12-6-16-13-8/h6-7,11H,3-5H2,1-2H3,(H,10,14) |
| InChIKey | YGNUFRPMOQJPLP-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 89.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|