C10H18N4O3 — CID 106398768
N-(3-methoxypropyl)-2-(1,2,4-oxadiazol-3-ylmethylamino)propanamide (PubChem CID 106398768) has the molecular formula C10H18N4O3 and a molecular weight of 242.28 g/mol. Its IUPAC name is N-(3-methoxypropyl)-2-(1,2,4-oxadiazol-3-ylmethylamino)propanamide.
| Compound Name | N-(3-methoxypropyl)-2-(1,2,4-oxadiazol-3-ylmethylamino)propanamide |
|---|---|
| PubChem CID | 106398768 |
| Molecular Formula | C10H18N4O3 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | N-(3-methoxypropyl)-2-(1,2,4-oxadiazol-3-ylmethylamino)propanamide |
| SMILES | COCCCNC(=O)C(C)NCc1ncon1 |
| InChI | InChI=1S/C10H18N4O3/c1-8(10(15)11-4-3-5-16-2)12-6-9-13-7-17-14-9/h7-8,12H,3-6H2,1-2H3,(H,11,15) |
| InChIKey | DAKCOWDQLYGWNC-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 89.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|