C12H22N4O2 — CID 82882044
N-(3-methoxypropyl)-2-[(1-methylpyrazol-3-yl)methylamino]propanamide (PubChem CID 82882044) has the molecular formula C12H22N4O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is N-(3-methoxypropyl)-2-[(1-methylpyrazol-3-yl)methylamino]propanamide.
| Compound Name | N-(3-methoxypropyl)-2-[(1-methylpyrazol-3-yl)methylamino]propanamide |
|---|---|
| PubChem CID | 82882044 |
| Molecular Formula | C12H22N4O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | N-(3-methoxypropyl)-2-[(1-methylpyrazol-3-yl)methylamino]propanamide |
| SMILES | COCCCNC(=O)C(C)NCc1ccn(C)n1 |
| InChI | InChI=1S/C12H22N4O2/c1-10(12(17)13-6-4-8-18-3)14-9-11-5-7-16(2)15-11/h5,7,10,14H,4,6,8-9H2,1-3H3,(H,13,17) |
| InChIKey | VGDIKONMRAPLMJ-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|