C8H15N3O2 — CID 106398904
N-(1,2,4-oxadiazol-3-ylmethyl)-2-propan-2-yloxyethanamine (PubChem CID 106398904) has the molecular formula C8H15N3O2 and a molecular weight of 185.23 g/mol. Its IUPAC name is N-(1,2,4-oxadiazol-3-ylmethyl)-2-propan-2-yloxyethanamine.
| Compound Name | N-(1,2,4-oxadiazol-3-ylmethyl)-2-propan-2-yloxyethanamine |
|---|---|
| PubChem CID | 106398904 |
| Molecular Formula | C8H15N3O2 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | N-(1,2,4-oxadiazol-3-ylmethyl)-2-propan-2-yloxyethanamine |
| SMILES | CC(C)OCCNCc1ncon1 |
| InChI | InChI=1S/C8H15N3O2/c1-7(2)12-4-3-9-5-8-10-6-13-11-8/h6-7,9H,3-5H2,1-2H3 |
| InChIKey | RZFFTPGTVIJMLY-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|