About 1-cyclopropyl-N-(1,2,4-oxadiazol-3-ylmethyl)ethanamine
1-cyclopropyl-N-(1,2,4-oxadiazol-3-ylmethyl)ethanamine (PubChem CID 106393050) has the molecular formula C8H13N3O
and a molecular weight of 167.21 g/mol. Its IUPAC name is 1-cyclopropyl-N-(1,2,4-oxadiazol-3-ylmethyl)ethanamine.
Analyze 1-cyclopropyl-N-(1,2,4-oxadiazol-3-ylmethyl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-N-(1,2,4-oxadiazol-3-ylmethyl)ethanamine?
The IUPAC name of 1-cyclopropyl-N-(1,2,4-oxadiazol-3-ylmethyl)ethanamine (CID 106393050) is 1-cyclopropyl-N-(1,2,4-oxadiazol-3-ylmethyl)ethanamine.
What is the SMILES notation for 1-cyclopropyl-N-(1,2,4-oxadiazol-3-ylmethyl)ethanamine?
The canonical SMILES for 1-cyclopropyl-N-(1,2,4-oxadiazol-3-ylmethyl)ethanamine is CC(NCc1ncon1)C1CC1.
What is the InChIKey of 1-cyclopropyl-N-(1,2,4-oxadiazol-3-ylmethyl)ethanamine?
The InChIKey is IILFFXOABIKVJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O/c1-6(7-2-3-7)9-4-8-10-5-12-11-8/h5-7,9H,2-4H2,1H3.
What are the key properties of 1-cyclopropyl-N-(1,2,4-oxadiazol-3-ylmethyl)ethanamine?
1-cyclopropyl-N-(1,2,4-oxadiazol-3-ylmethyl)ethanamine has a molecular weight of 167.21 g/mol, XLogP of 0.96, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-N-(1,2,4-oxadiazol-3-ylmethyl)ethanamine is sourced from PubChem (CID 106393050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).