About 2,2-difluoro-N-(1,2,4-oxadiazol-3-ylmethyl)ethanamine
2,2-difluoro-N-(1,2,4-oxadiazol-3-ylmethyl)ethanamine (PubChem CID 106399000) has the molecular formula C5H7F2N3O
and a molecular weight of 163.13 g/mol. Its IUPAC name is 2,2-difluoro-N-(1,2,4-oxadiazol-3-ylmethyl)ethanamine.
Analyze 2,2-difluoro-N-(1,2,4-oxadiazol-3-ylmethyl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoro-N-(1,2,4-oxadiazol-3-ylmethyl)ethanamine?
The IUPAC name of 2,2-difluoro-N-(1,2,4-oxadiazol-3-ylmethyl)ethanamine (CID 106399000) is 2,2-difluoro-N-(1,2,4-oxadiazol-3-ylmethyl)ethanamine.
What is the SMILES notation for 2,2-difluoro-N-(1,2,4-oxadiazol-3-ylmethyl)ethanamine?
The canonical SMILES for 2,2-difluoro-N-(1,2,4-oxadiazol-3-ylmethyl)ethanamine is FC(F)CNCc1ncon1.
What is the InChIKey of 2,2-difluoro-N-(1,2,4-oxadiazol-3-ylmethyl)ethanamine?
The InChIKey is BIAHJZWRDZFYTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7F2N3O/c6-4(7)1-8-2-5-9-3-11-10-5/h3-4,8H,1-2H2.
What are the key properties of 2,2-difluoro-N-(1,2,4-oxadiazol-3-ylmethyl)ethanamine?
2,2-difluoro-N-(1,2,4-oxadiazol-3-ylmethyl)ethanamine has a molecular weight of 163.13 g/mol, XLogP of 0.42, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-N-(1,2,4-oxadiazol-3-ylmethyl)ethanamine is sourced from PubChem (CID 106399000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).