C7H10BrN3O3 — CID 106401835
methyl 2-bromo-3-(1,2,4-oxadiazol-3-ylmethylamino)propanoate (PubChem CID 106401835) has the molecular formula C7H10BrN3O3 and a molecular weight of 264.08 g/mol. Its IUPAC name is methyl 2-bromo-3-(1,2,4-oxadiazol-3-ylmethylamino)propanoate.
| Compound Name | methyl 2-bromo-3-(1,2,4-oxadiazol-3-ylmethylamino)propanoate |
|---|---|
| PubChem CID | 106401835 |
| Molecular Formula | C7H10BrN3O3 |
| Molecular Weight | 264.08 g/mol |
| Exact Mass | 262.99 |
| IUPAC Name | methyl 2-bromo-3-(1,2,4-oxadiazol-3-ylmethylamino)propanoate |
| SMILES | COC(=O)C(Br)CNCc1ncon1 |
| InChI | InChI=1S/C7H10BrN3O3/c1-13-7(12)5(8)2-9-3-6-10-4-14-11-6/h4-5,9H,2-3H2,1H3 |
| InChIKey | HRCZEIWUXSNTFS-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.08 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|