C8H11BrN2O3 — CID 103259745
methyl 2-bromo-3-(1,2-oxazol-3-ylmethylamino)propanoate (PubChem CID 103259745) has the molecular formula C8H11BrN2O3 and a molecular weight of 263.09 g/mol. Its IUPAC name is methyl 2-bromo-3-(1,2-oxazol-3-ylmethylamino)propanoate.
| Compound Name | methyl 2-bromo-3-(1,2-oxazol-3-ylmethylamino)propanoate |
|---|---|
| PubChem CID | 103259745 |
| Molecular Formula | C8H11BrN2O3 |
| Molecular Weight | 263.09 g/mol |
| Exact Mass | 262.00 |
| IUPAC Name | methyl 2-bromo-3-(1,2-oxazol-3-ylmethylamino)propanoate |
| SMILES | COC(=O)C(Br)CNCc1ccon1 |
| InChI | InChI=1S/C8H11BrN2O3/c1-13-8(12)7(9)5-10-4-6-2-3-14-11-6/h2-3,7,10H,4-5H2,1H3 |
| InChIKey | GIBXUVMGJUVDLE-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.09 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|