C11H12BrCl2NO2 — CID 103492200
methyl 2-bromo-3-[(2,5-dichlorophenyl)methylamino]propanoate (PubChem CID 103492200) has the molecular formula C11H12BrCl2NO2 and a molecular weight of 341.03 g/mol. Its IUPAC name is methyl 2-bromo-3-[(2,5-dichlorophenyl)methylamino]propanoate.
| Compound Name | methyl 2-bromo-3-[(2,5-dichlorophenyl)methylamino]propanoate |
|---|---|
| PubChem CID | 103492200 |
| Molecular Formula | C11H12BrCl2NO2 |
| Molecular Weight | 341.03 g/mol |
| Exact Mass | 338.94 |
| IUPAC Name | methyl 2-bromo-3-[(2,5-dichlorophenyl)methylamino]propanoate |
| SMILES | COC(=O)C(Br)CNCc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C11H12BrCl2NO2/c1-17-11(16)9(12)6-15-5-7-4-8(13)2-3-10(7)14/h2-4,9,15H,5-6H2,1H3 |
| InChIKey | CLIJOGPYXVOELJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.03 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|