methyl 2-bromo-3-[1-(2,4-dichlorophenyl)ethylamino]propanoate

C12H14BrCl2NO2 — CID 103233959

IUPACmethyl 2-bromo-3-[1-(2,4-dichlorophenyl)ethylamino]propanoate
SMILESCOC(=O)C(Br)CNC(C)c1ccc(Cl)cc1Cl
InChIInChI=1S/C12H14BrCl2NO2/c1-7(16-6-10(13)12(17)18-2)9-4-3-8(14)5-11(9)15/h3-5,7,10,16H,6H2,1-2H3
InChIKeyVZZCQJBAKWLDGM-UHFFFAOYSA-N
MW355.06 g/mol
LogP3.58
Rot. Bonds5

About methyl 2-bromo-3-[1-(2,4-dichlorophenyl)ethylamino]propanoate

methyl 2-bromo-3-[1-(2,4-dichlorophenyl)ethylamino]propanoate (PubChem CID 103233959) has the molecular formula C12H14BrCl2NO2 and a molecular weight of 355.06 g/mol. Its IUPAC name is methyl 2-bromo-3-[1-(2,4-dichlorophenyl)ethylamino]propanoate.

Molecular Properties

Compound Namemethyl 2-bromo-3-[1-(2,4-dichlorophenyl)ethylamino]propanoate
PubChem CID103233959
Molecular FormulaC12H14BrCl2NO2
Molecular Weight355.06 g/mol
Exact Mass352.96
IUPAC Namemethyl 2-bromo-3-[1-(2,4-dichlorophenyl)ethylamino]propanoate
SMILESCOC(=O)C(Br)CNC(C)c1ccc(Cl)cc1Cl
InChIInChI=1S/C12H14BrCl2NO2/c1-7(16-6-10(13)12(17)18-2)9-4-3-8(14)5-11(9)15/h3-5,7,10,16H,6H2,1-2H3
InChIKeyVZZCQJBAKWLDGM-UHFFFAOYSA-N
XLogP3.58
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500355.06
LogP ≤ 53.58
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze methyl 2-bromo-3-[1-(2,4-dichlorophenyl)ethylamino]propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-bromo-3-[1-(2,4-dichlorophenyl)ethylamino]propanoate?
The IUPAC name of methyl 2-bromo-3-[1-(2,4-dichlorophenyl)ethylamino]propanoate (CID 103233959) is methyl 2-bromo-3-[1-(2,4-dichlorophenyl)ethylamino]propanoate.
What is the SMILES notation for methyl 2-bromo-3-[1-(2,4-dichlorophenyl)ethylamino]propanoate?
The canonical SMILES for methyl 2-bromo-3-[1-(2,4-dichlorophenyl)ethylamino]propanoate is COC(=O)C(Br)CNC(C)c1ccc(Cl)cc1Cl.
What is the InChIKey of methyl 2-bromo-3-[1-(2,4-dichlorophenyl)ethylamino]propanoate?
The InChIKey is VZZCQJBAKWLDGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14BrCl2NO2/c1-7(16-6-10(13)12(17)18-2)9-4-3-8(14)5-11(9)15/h3-5,7,10,16H,6H2,1-2H3.
What are the key properties of methyl 2-bromo-3-[1-(2,4-dichlorophenyl)ethylamino]propanoate?
methyl 2-bromo-3-[1-(2,4-dichlorophenyl)ethylamino]propanoate has a molecular weight of 355.06 g/mol, XLogP of 3.58, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-bromo-3-[1-(2,4-dichlorophenyl)ethylamino]propanoate is sourced from PubChem (CID 103233959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).