C14H21Cl2N — CID 43095140
N-[1-(2,4-dichlorophenyl)ethyl]-2-methylpentan-1-amine (PubChem CID 43095140) has the molecular formula C14H21Cl2N and a molecular weight of 274.24 g/mol. Its IUPAC name is N-[1-(2,4-dichlorophenyl)ethyl]-2-methylpentan-1-amine.
| Compound Name | N-[1-(2,4-dichlorophenyl)ethyl]-2-methylpentan-1-amine |
|---|---|
| PubChem CID | 43095140 |
| Molecular Formula | C14H21Cl2N |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | N-[1-(2,4-dichlorophenyl)ethyl]-2-methylpentan-1-amine |
| SMILES | CCCC(C)CNC(C)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H21Cl2N/c1-4-5-10(2)9-17-11(3)13-7-6-12(15)8-14(13)16/h6-8,10-11,17H,4-5,9H2,1-3H3 |
| InChIKey | XFBRNGXXHRHDTR-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |