C13H17Cl2NO — CID 63294934
1-cyclopropyl-2-[1-(2,4-dichlorophenyl)ethylamino]ethanol (PubChem CID 63294934) has the molecular formula C13H17Cl2NO and a molecular weight of 274.19 g/mol. Its IUPAC name is 1-cyclopropyl-2-[1-(2,4-dichlorophenyl)ethylamino]ethanol.
| Compound Name | 1-cyclopropyl-2-[1-(2,4-dichlorophenyl)ethylamino]ethanol |
|---|---|
| PubChem CID | 63294934 |
| Molecular Formula | C13H17Cl2NO |
| Molecular Weight | 274.19 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 1-cyclopropyl-2-[1-(2,4-dichlorophenyl)ethylamino]ethanol |
| SMILES | CC(NCC(O)C1CC1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H17Cl2NO/c1-8(16-7-13(17)9-2-3-9)11-5-4-10(14)6-12(11)15/h4-6,8-9,13,16-17H,2-3,7H2,1H3 |
| InChIKey | IYVZCLJOPKZBKQ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.19 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |