C12H13Cl2N — CID 62312519
N-[1-(2,4-dichlorophenyl)ethyl]but-2-yn-1-amine (PubChem CID 62312519) has the molecular formula C12H13Cl2N and a molecular weight of 242.15 g/mol. Its IUPAC name is N-[1-(2,4-dichlorophenyl)ethyl]but-2-yn-1-amine.
| Compound Name | N-[1-(2,4-dichlorophenyl)ethyl]but-2-yn-1-amine |
|---|---|
| PubChem CID | 62312519 |
| Molecular Formula | C12H13Cl2N |
| Molecular Weight | 242.15 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | N-[1-(2,4-dichlorophenyl)ethyl]but-2-yn-1-amine |
| SMILES | CC#CCNC(C)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H13Cl2N/c1-3-4-7-15-9(2)11-6-5-10(13)8-12(11)14/h5-6,8-9,15H,7H2,1-2H3 |
| InChIKey | KUWQEOMMJCZSBN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.15 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|