C12H14Cl2N2 — CID 28579571
4-[[(1R)-1-(2,4-dichlorophenyl)ethyl]amino]butanenitrile (PubChem CID 28579571) has the molecular formula C12H14Cl2N2 and a molecular weight of 257.16 g/mol. Its IUPAC name is 4-[[(1R)-1-(2,4-dichlorophenyl)ethyl]amino]butanenitrile.
| Compound Name | 4-[[(1R)-1-(2,4-dichlorophenyl)ethyl]amino]butanenitrile |
|---|---|
| PubChem CID | 28579571 |
| Molecular Formula | C12H14Cl2N2 |
| Molecular Weight | 257.16 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 4-[[(1R)-1-(2,4-dichlorophenyl)ethyl]amino]butanenitrile |
| SMILES | C[C@@H](NCCCC#N)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H14Cl2N2/c1-9(16-7-3-2-6-15)11-5-4-10(13)8-12(11)14/h4-5,8-9,16H,2-3,7H2,1H3/t9-/m1/s1 |
| InChIKey | FHNCOMGESHBWHJ-SECBINFHSA-N |
| XLogP | 3.95 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.16 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|