C13H15Cl2N — CID 115819724
1-(2,4-dichlorophenyl)-N-ethylpent-3-yn-1-amine (PubChem CID 115819724) has the molecular formula C13H15Cl2N and a molecular weight of 256.18 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-N-ethylpent-3-yn-1-amine.
| Compound Name | 1-(2,4-dichlorophenyl)-N-ethylpent-3-yn-1-amine |
|---|---|
| PubChem CID | 115819724 |
| Molecular Formula | C13H15Cl2N |
| Molecular Weight | 256.18 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-N-ethylpent-3-yn-1-amine |
| SMILES | CC#CCC(NCC)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H15Cl2N/c1-3-5-6-13(16-4-2)11-8-7-10(14)9-12(11)15/h7-9,13,16H,4,6H2,1-2H3 |
| InChIKey | WKOZVEUREIJFLN-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.18 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|