C14H20N2 — CID 105112281
1-(2,6-dimethyl-3-pyridinyl)-N-ethylpent-3-yn-1-amine (PubChem CID 105112281) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 1-(2,6-dimethyl-3-pyridinyl)-N-ethylpent-3-yn-1-amine.
| Compound Name | 1-(2,6-dimethyl-3-pyridinyl)-N-ethylpent-3-yn-1-amine |
|---|---|
| PubChem CID | 105112281 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 1-(2,6-dimethyl-3-pyridinyl)-N-ethylpent-3-yn-1-amine |
| SMILES | CC#CCC(NCC)c1ccc(C)nc1C |
| InChI | InChI=1S/C14H20N2/c1-5-7-8-14(15-6-2)13-10-9-11(3)16-12(13)4/h9-10,14-15H,6,8H2,1-4H3 |
| InChIKey | SBGLYJROPCKYAL-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|