C12H16N2 — CID 105112231
1-(2,6-dimethyl-3-pyridinyl)pent-3-yn-1-amine (PubChem CID 105112231) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 1-(2,6-dimethyl-3-pyridinyl)pent-3-yn-1-amine.
| Compound Name | 1-(2,6-dimethyl-3-pyridinyl)pent-3-yn-1-amine |
|---|---|
| PubChem CID | 105112231 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 1-(2,6-dimethyl-3-pyridinyl)pent-3-yn-1-amine |
| SMILES | CC#CCC(N)c1ccc(C)nc1C |
| InChI | InChI=1S/C12H16N2/c1-4-5-6-12(13)11-8-7-9(2)14-10(11)3/h7-8,12H,6,13H2,1-3H3 |
| InChIKey | IRRXOGXKLAAFFF-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|