C13H17NO — CID 105126569
1-(2,6-dimethyl-3-pyridinyl)hex-4-yn-1-ol (PubChem CID 105126569) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is 1-(2,6-dimethyl-3-pyridinyl)hex-4-yn-1-ol.
| Compound Name | 1-(2,6-dimethyl-3-pyridinyl)hex-4-yn-1-ol |
|---|---|
| PubChem CID | 105126569 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 1-(2,6-dimethyl-3-pyridinyl)hex-4-yn-1-ol |
| SMILES | CC#CCCC(O)c1ccc(C)nc1C |
| InChI | InChI=1S/C13H17NO/c1-4-5-6-7-13(15)12-9-8-10(2)14-11(12)3/h8-9,13,15H,6-7H2,1-3H3 |
| InChIKey | XVYRMRLKDBEPJR-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|