C16H27NO — CID 105085795
1-(2,6-dimethyl-3-pyridinyl)nonan-1-ol (PubChem CID 105085795) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is 1-(2,6-dimethyl-3-pyridinyl)nonan-1-ol.
| Compound Name | 1-(2,6-dimethyl-3-pyridinyl)nonan-1-ol |
|---|---|
| PubChem CID | 105085795 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | 1-(2,6-dimethyl-3-pyridinyl)nonan-1-ol |
| SMILES | CCCCCCCCC(O)c1ccc(C)nc1C |
| InChI | InChI=1S/C16H27NO/c1-4-5-6-7-8-9-10-16(18)15-12-11-13(2)17-14(15)3/h11-12,16,18H,4-10H2,1-3H3 |
| InChIKey | JGTZKONCNRDCAO-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|