C12H19NO — CID 105085207
1-(2,6-dimethyl-3-pyridinyl)pentan-1-ol (PubChem CID 105085207) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 1-(2,6-dimethyl-3-pyridinyl)pentan-1-ol.
| Compound Name | 1-(2,6-dimethyl-3-pyridinyl)pentan-1-ol |
|---|---|
| PubChem CID | 105085207 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 1-(2,6-dimethyl-3-pyridinyl)pentan-1-ol |
| SMILES | CCCCC(O)c1ccc(C)nc1C |
| InChI | InChI=1S/C12H19NO/c1-4-5-6-12(14)11-8-7-9(2)13-10(11)3/h7-8,12,14H,4-6H2,1-3H3 |
| InChIKey | WGEFNYJBYWLBMS-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |