C14H18O — CID 104809723
1-(2,6-dimethylphenyl)hex-4-yn-1-ol (PubChem CID 104809723) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)hex-4-yn-1-ol.
| Compound Name | 1-(2,6-dimethylphenyl)hex-4-yn-1-ol |
|---|---|
| PubChem CID | 104809723 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 1-(2,6-dimethylphenyl)hex-4-yn-1-ol |
| SMILES | CC#CCCC(O)c1c(C)cccc1C |
| InChI | InChI=1S/C14H18O/c1-4-5-6-10-13(15)14-11(2)8-7-9-12(14)3/h7-9,13,15H,6,10H2,1-3H3 |
| InChIKey | BEZDVOVVSASCRX-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|