C14H17BrO — CID 114329886
1-(4-bromo-3,5-dimethylphenyl)hex-4-yn-1-ol (PubChem CID 114329886) has the molecular formula C14H17BrO and a molecular weight of 281.19 g/mol. Its IUPAC name is 1-(4-bromo-3,5-dimethylphenyl)hex-4-yn-1-ol.
| Compound Name | 1-(4-bromo-3,5-dimethylphenyl)hex-4-yn-1-ol |
|---|---|
| PubChem CID | 114329886 |
| Molecular Formula | C14H17BrO |
| Molecular Weight | 281.19 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 1-(4-bromo-3,5-dimethylphenyl)hex-4-yn-1-ol |
| SMILES | CC#CCCC(O)c1cc(C)c(Br)c(C)c1 |
| InChI | InChI=1S/C14H17BrO/c1-4-5-6-7-13(16)12-8-10(2)14(15)11(3)9-12/h8-9,13,16H,6-7H2,1-3H3 |
| InChIKey | SCDFYHNEMLPUSV-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.19 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|