C17H27BrO — CID 114329962
1-(4-bromo-3,5-dimethylphenyl)-3-ethylheptan-1-ol (PubChem CID 114329962) has the molecular formula C17H27BrO and a molecular weight of 327.31 g/mol. Its IUPAC name is 1-(4-bromo-3,5-dimethylphenyl)-3-ethylheptan-1-ol.
| Compound Name | 1-(4-bromo-3,5-dimethylphenyl)-3-ethylheptan-1-ol |
|---|---|
| PubChem CID | 114329962 |
| Molecular Formula | C17H27BrO |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 1-(4-bromo-3,5-dimethylphenyl)-3-ethylheptan-1-ol |
| SMILES | CCCCC(CC)CC(O)c1cc(C)c(Br)c(C)c1 |
| InChI | InChI=1S/C17H27BrO/c1-5-7-8-14(6-2)11-16(19)15-9-12(3)17(18)13(4)10-15/h9-10,14,16,19H,5-8,11H2,1-4H3 |
| InChIKey | RLQKSQBSUMAUHT-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |