C10H22O — CID 7015159
(2R,4S)-4-ethyloctan-2-ol (PubChem CID 7015159) has the molecular formula C10H22O and a molecular weight of 158.28 g/mol. Its IUPAC name is (2R,4S)-4-ethyloctan-2-ol.
| Compound Name | (2R,4S)-4-ethyloctan-2-ol |
|---|---|
| PubChem CID | 7015159 |
| Molecular Formula | C10H22O |
| Molecular Weight | 158.28 g/mol |
| Exact Mass | 158.17 |
| IUPAC Name | (2R,4S)-4-ethyloctan-2-ol |
| SMILES | CCCC[C@H](CC)C[C@@H](C)O |
| InChI | InChI=1S/C10H22O/c1-4-6-7-10(5-2)8-9(3)11/h9-11H,4-8H2,1-3H3/t9-,10+/m1/s1 |
| InChIKey | GVKBTEISGUWZEJ-ZJUUUORDSA-N |
| XLogP | 2.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.28 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |