C14H30O3 — CID 123693494
3-(2-ethylhexoxy)hexane-2,5-diol (PubChem CID 123693494) has the molecular formula C14H30O3 and a molecular weight of 246.39 g/mol. Its IUPAC name is 3-(2-ethylhexoxy)hexane-2,5-diol.
| Compound Name | 3-(2-ethylhexoxy)hexane-2,5-diol |
|---|---|
| PubChem CID | 123693494 |
| Molecular Formula | C14H30O3 |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.22 |
| IUPAC Name | 3-(2-ethylhexoxy)hexane-2,5-diol |
| SMILES | CCCCC(CC)COC(CC(C)O)C(C)O |
| InChI | InChI=1S/C14H30O3/c1-5-7-8-13(6-2)10-17-14(12(4)16)9-11(3)15/h11-16H,5-10H2,1-4H3 |
| InChIKey | KHLCBVLWLOEIOR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |