C18H38O3 — CID 118435982
2,2-bis(2-ethylhexoxy)ethanol (PubChem CID 118435982) has the molecular formula C18H38O3 and a molecular weight of 302.50 g/mol. Its IUPAC name is 2,2-bis(2-ethylhexoxy)ethanol.
| Compound Name | 2,2-bis(2-ethylhexoxy)ethanol |
|---|---|
| PubChem CID | 118435982 |
| Molecular Formula | C18H38O3 |
| Molecular Weight | 302.50 g/mol |
| Exact Mass | 302.28 |
| IUPAC Name | 2,2-bis(2-ethylhexoxy)ethanol |
| SMILES | CCCCC(CC)COC(CO)OCC(CC)CCCC |
| InChI | InChI=1S/C18H38O3/c1-5-9-11-16(7-3)14-20-18(13-19)21-15-17(8-4)12-10-6-2/h16-19H,5-15H2,1-4H3 |
| InChIKey | DOLKARRHNGWSKH-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.50 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|