About 1-Hexanol, 2-ethyl-, magnesium salt (2:1)
1-Hexanol, 2-ethyl-, magnesium salt (2:1) (PubChem CID 74764164) has the molecular formula C8H18MgO
and a molecular weight of 154.54 g/mol.
Analyze 1-Hexanol, 2-ethyl-, magnesium salt (2:1) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-Hexanol, 2-ethyl-, magnesium salt (2:1)?
The IUPAC name of 1-Hexanol, 2-ethyl-, magnesium salt (2:1) (CID 74764164) is not available.
What is the SMILES notation for 1-Hexanol, 2-ethyl-, magnesium salt (2:1)?
The canonical SMILES for 1-Hexanol, 2-ethyl-, magnesium salt (2:1) is CCCCC(CC)CO.[Mg].
What is the InChIKey of 1-Hexanol, 2-ethyl-, magnesium salt (2:1)?
The InChIKey is WVWIZJDEQLMIQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O.Mg/c1-3-5-6-8(4-2)7-9;/h8-9H,3-7H2,1-2H3;.
What are the key properties of 1-Hexanol, 2-ethyl-, magnesium salt (2:1)?
1-Hexanol, 2-ethyl-, magnesium salt (2:1) has a molecular weight of 154.54 g/mol, XLogP of 1.81, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-Hexanol, 2-ethyl-, magnesium salt (2:1) is sourced from PubChem (CID 74764164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).