About 2-ethylhexan-1-ol;zirconium;trihydrochloride
2-ethylhexan-1-ol;zirconium;trihydrochloride (PubChem CID 173397810) has the molecular formula C8H21Cl3OZr
and a molecular weight of 330.84 g/mol. Its IUPAC name is 2-ethylhexan-1-ol;zirconium;trihydrochloride.
Molecular Properties
| Compound Name | 2-ethylhexan-1-ol;zirconium;trihydrochloride |
| PubChem CID | 173397810 |
| Molecular Formula | C8H21Cl3OZr |
| Molecular Weight | 330.84 g/mol |
| Exact Mass | 327.97 |
| IUPAC Name | 2-ethylhexan-1-ol;zirconium;trihydrochloride |
| SMILES | CCCCC(CC)CO.Cl.Cl.Cl.[Zr] |
| InChI | InChI=1S/C8H18O.3ClH.Zr/c1-3-5-6-8(4-2)7-9;;;;/h8-9H,3-7H2,1-2H3;3*1H; |
| InChIKey | IWSZSXLQCHDDPW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.84 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethylhexan-1-ol;zirconium;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexan-1-ol;zirconium;trihydrochloride?
The IUPAC name of 2-ethylhexan-1-ol;zirconium;trihydrochloride (CID 173397810) is 2-ethylhexan-1-ol;zirconium;trihydrochloride.
What is the SMILES notation for 2-ethylhexan-1-ol;zirconium;trihydrochloride?
The canonical SMILES for 2-ethylhexan-1-ol;zirconium;trihydrochloride is CCCCC(CC)CO.Cl.Cl.Cl.[Zr].
What is the InChIKey of 2-ethylhexan-1-ol;zirconium;trihydrochloride?
The InChIKey is IWSZSXLQCHDDPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O.3ClH.Zr/c1-3-5-6-8(4-2)7-9;;;;/h8-9H,3-7H2,1-2H3;3*1H;.
What are the key properties of 2-ethylhexan-1-ol;zirconium;trihydrochloride?
2-ethylhexan-1-ol;zirconium;trihydrochloride has a molecular weight of 330.84 g/mol, XLogP of 3.46, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexan-1-ol;zirconium;trihydrochloride is sourced from PubChem (CID 173397810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).