About sodium;2-ethylhexan-1-ol;sulfate
sodium;2-ethylhexan-1-ol;sulfate (PubChem CID 20976016) has the molecular formula C8H18NaO5S-
and a molecular weight of 249.28 g/mol. Its IUPAC name is sodium;2-ethylhexan-1-ol;sulfate.
Molecular Properties
| Compound Name | sodium;2-ethylhexan-1-ol;sulfate |
| PubChem CID | 20976016 |
| Molecular Formula | C8H18NaO5S- |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | sodium;2-ethylhexan-1-ol;sulfate |
| SMILES | CCCCC(CC)CO.O=S(=O)([O-])[O-].[Na+] |
| InChI | InChI=1S/C8H18O.Na.H2O4S/c1-3-5-6-8(4-2)7-9;;1-5(2,3)4/h8-9H,3-7H2,1-2H3;;(H2,1,2,3,4)/q;+1;/p-2 |
| InChIKey | LLBYKNCXLWUARQ-UHFFFAOYSA-L |
| XLogP | -2.14 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze sodium;2-ethylhexan-1-ol;sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2-ethylhexan-1-ol;sulfate?
The IUPAC name of sodium;2-ethylhexan-1-ol;sulfate (CID 20976016) is sodium;2-ethylhexan-1-ol;sulfate.
What is the SMILES notation for sodium;2-ethylhexan-1-ol;sulfate?
The canonical SMILES for sodium;2-ethylhexan-1-ol;sulfate is CCCCC(CC)CO.O=S(=O)([O-])[O-].[Na+].
What is the InChIKey of sodium;2-ethylhexan-1-ol;sulfate?
The InChIKey is LLBYKNCXLWUARQ-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H18O.Na.H2O4S/c1-3-5-6-8(4-2)7-9;;1-5(2,3)4/h8-9H,3-7H2,1-2H3;;(H2,1,2,3,4)/q;+1;/p-2.
What are the key properties of sodium;2-ethylhexan-1-ol;sulfate?
sodium;2-ethylhexan-1-ol;sulfate has a molecular weight of 249.28 g/mol, XLogP of -2.14, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2-ethylhexan-1-ol;sulfate is sourced from PubChem (CID 20976016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).