About butanedioic acid;2-ethylhexan-1-ol
butanedioic acid;2-ethylhexan-1-ol (PubChem CID 159770263) has the molecular formula C12H24O5
and a molecular weight of 248.32 g/mol. Its IUPAC name is butanedioic acid;2-ethylhexan-1-ol.
Molecular Properties
| Compound Name | butanedioic acid;2-ethylhexan-1-ol |
| PubChem CID | 159770263 |
| Molecular Formula | C12H24O5 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | butanedioic acid;2-ethylhexan-1-ol |
| SMILES | CCCCC(CC)CO.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C8H18O.C4H6O4/c1-3-5-6-8(4-2)7-9;5-3(6)1-2-4(7)8/h8-9H,3-7H2,1-2H3;1-2H2,(H,5,6)(H,7,8) |
| InChIKey | NGAGBBFWRUHZGB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze butanedioic acid;2-ethylhexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanedioic acid;2-ethylhexan-1-ol?
The IUPAC name of butanedioic acid;2-ethylhexan-1-ol (CID 159770263) is butanedioic acid;2-ethylhexan-1-ol.
What is the SMILES notation for butanedioic acid;2-ethylhexan-1-ol?
The canonical SMILES for butanedioic acid;2-ethylhexan-1-ol is CCCCC(CC)CO.O=C(O)CCC(=O)O.
What is the InChIKey of butanedioic acid;2-ethylhexan-1-ol?
The InChIKey is NGAGBBFWRUHZGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O.C4H6O4/c1-3-5-6-8(4-2)7-9;5-3(6)1-2-4(7)8/h8-9H,3-7H2,1-2H3;1-2H2,(H,5,6)(H,7,8).
What are the key properties of butanedioic acid;2-ethylhexan-1-ol?
butanedioic acid;2-ethylhexan-1-ol has a molecular weight of 248.32 g/mol, XLogP of 2.13, 8 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butanedioic acid;2-ethylhexan-1-ol is sourced from PubChem (CID 159770263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).