About CID 159249113
CID 159249113 (PubChem CID 159249113) has the molecular formula C8H18BiOTi
and a molecular weight of 387.08 g/mol.
Molecular Properties
| Compound Name | CID 159249113 |
| PubChem CID | 159249113 |
| Molecular Formula | C8H18BiOTi |
| Molecular Weight | 387.08 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | — |
| SMILES | CCCCC(CC)CO.[Bi].[Ti] |
| InChI | InChI=1S/C8H18O.Bi.Ti/c1-3-5-6-8(4-2)7-9;;/h8-9H,3-7H2,1-2H3;; |
| InChIKey | XLJOOMCSNVKJSW-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.08 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 159249113 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159249113?
The IUPAC name of CID 159249113 (CID 159249113) is not available.
What is the SMILES notation for CID 159249113?
The canonical SMILES for CID 159249113 is CCCCC(CC)CO.[Bi].[Ti].
What is the InChIKey of CID 159249113?
The InChIKey is XLJOOMCSNVKJSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O.Bi.Ti/c1-3-5-6-8(4-2)7-9;;/h8-9H,3-7H2,1-2H3;;.
What are the key properties of CID 159249113?
CID 159249113 has a molecular weight of 387.08 g/mol, XLogP of 1.81, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159249113 is sourced from PubChem (CID 159249113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).