C13H30O3 — CID 139528593
ethane-1,2-diol;2-ethylhexan-1-ol;prop-1-ene (PubChem CID 139528593) has the molecular formula C13H30O3 and a molecular weight of 234.38 g/mol. Its IUPAC name is ethane-1,2-diol;2-ethylhexan-1-ol;prop-1-ene.
| Compound Name | ethane-1,2-diol;2-ethylhexan-1-ol;prop-1-ene |
|---|---|
| PubChem CID | 139528593 |
| Molecular Formula | C13H30O3 |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.22 |
| IUPAC Name | ethane-1,2-diol;2-ethylhexan-1-ol;prop-1-ene |
| SMILES | C=CC.CCCCC(CC)CO.OCCO |
| InChI | InChI=1S/C8H18O.C3H6.C2H6O2/c1-3-5-6-8(4-2)7-9;1-3-2;3-1-2-4/h8-9H,3-7H2,1-2H3;3H,1H2,2H3;3-4H,1-2H2 |
| InChIKey | YPXUCAOMHCERAO-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|