About 2-ethylhexan-1-ol;hydron
2-ethylhexan-1-ol;hydron (PubChem CID 175010288) has the molecular formula C8H19O+
and a molecular weight of 131.24 g/mol. Its IUPAC name is 2-ethylhexan-1-ol;hydron.
Molecular Properties
| Compound Name | 2-ethylhexan-1-ol;hydron |
| PubChem CID | 175010288 |
| Molecular Formula | C8H19O+ |
| Molecular Weight | 131.24 g/mol |
| Exact Mass | 131.14 |
| IUPAC Name | 2-ethylhexan-1-ol;hydron |
| SMILES | CCCCC(CC)CO.[H+] |
| InChI | InChI=1S/C8H18O/c1-3-5-6-8(4-2)7-9/h8-9H,3-7H2,1-2H3/p+1 |
| InChIKey | YIWUKEYIRIRTPP-UHFFFAOYSA-O |
| XLogP | 2.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.24 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethylhexan-1-ol;hydron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexan-1-ol;hydron?
The IUPAC name of 2-ethylhexan-1-ol;hydron (CID 175010288) is 2-ethylhexan-1-ol;hydron.
What is the SMILES notation for 2-ethylhexan-1-ol;hydron?
The canonical SMILES for 2-ethylhexan-1-ol;hydron is CCCCC(CC)CO.[H+].
What is the InChIKey of 2-ethylhexan-1-ol;hydron?
The InChIKey is YIWUKEYIRIRTPP-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H18O/c1-3-5-6-8(4-2)7-9/h8-9H,3-7H2,1-2H3/p+1.
What are the key properties of 2-ethylhexan-1-ol;hydron?
2-ethylhexan-1-ol;hydron has a molecular weight of 131.24 g/mol, XLogP of 2.31, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexan-1-ol;hydron is sourced from PubChem (CID 175010288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).