About 2-ethylhexan-1-ol;trichlorotitanium
2-ethylhexan-1-ol;trichlorotitanium (PubChem CID 22251739) has the molecular formula C8H18Cl3OTi
and a molecular weight of 284.46 g/mol. Its IUPAC name is 2-ethylhexan-1-ol;trichlorotitanium.
Molecular Properties
| Compound Name | 2-ethylhexan-1-ol;trichlorotitanium |
| PubChem CID | 22251739 |
| Molecular Formula | C8H18Cl3OTi |
| Molecular Weight | 284.46 g/mol |
| Exact Mass | 282.99 |
| IUPAC Name | 2-ethylhexan-1-ol;trichlorotitanium |
| SMILES | CCCCC(CC)CO.Cl[Ti](Cl)Cl |
| InChI | InChI=1S/C8H18O.3ClH.Ti/c1-3-5-6-8(4-2)7-9;;;;/h8-9H,3-7H2,1-2H3;3*1H;/q;;;;+3/p-3 |
| InChIKey | BKRBIVQINBXKOS-UHFFFAOYSA-K |
| XLogP | 4.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.46 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethylhexan-1-ol;trichlorotitanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexan-1-ol;trichlorotitanium?
The IUPAC name of 2-ethylhexan-1-ol;trichlorotitanium (CID 22251739) is 2-ethylhexan-1-ol;trichlorotitanium.
What is the SMILES notation for 2-ethylhexan-1-ol;trichlorotitanium?
The canonical SMILES for 2-ethylhexan-1-ol;trichlorotitanium is CCCCC(CC)CO.Cl[Ti](Cl)Cl.
What is the InChIKey of 2-ethylhexan-1-ol;trichlorotitanium?
The InChIKey is BKRBIVQINBXKOS-UHFFFAOYSA-K. The full InChI is InChI=1S/C8H18O.3ClH.Ti/c1-3-5-6-8(4-2)7-9;;;;/h8-9H,3-7H2,1-2H3;3*1H;/q;;;;+3/p-3.
What are the key properties of 2-ethylhexan-1-ol;trichlorotitanium?
2-ethylhexan-1-ol;trichlorotitanium has a molecular weight of 284.46 g/mol, XLogP of 4.26, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexan-1-ol;trichlorotitanium is sourced from PubChem (CID 22251739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).