About 2-ethylhexan-1-ol;3-hydroxyprop-2-enoic acid
2-ethylhexan-1-ol;3-hydroxyprop-2-enoic acid (PubChem CID 174892129) has the molecular formula C11H22O4
and a molecular weight of 218.29 g/mol. Its IUPAC name is 2-ethylhexan-1-ol;3-hydroxyprop-2-enoic acid.
Molecular Properties
| Compound Name | 2-ethylhexan-1-ol;3-hydroxyprop-2-enoic acid |
| PubChem CID | 174892129 |
| Molecular Formula | C11H22O4 |
| Molecular Weight | 218.29 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 2-ethylhexan-1-ol;3-hydroxyprop-2-enoic acid |
| SMILES | CCCCC(CC)CO.O=C(O)C=CO |
| InChI | InChI=1S/C8H18O.C3H4O3/c1-3-5-6-8(4-2)7-9;4-2-1-3(5)6/h8-9H,3-7H2,1-2H3;1-2,4H,(H,5,6) |
| InChIKey | CAUPDAWXPOMRJB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.29 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylhexan-1-ol;3-hydroxyprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexan-1-ol;3-hydroxyprop-2-enoic acid?
The IUPAC name of 2-ethylhexan-1-ol;3-hydroxyprop-2-enoic acid (CID 174892129) is 2-ethylhexan-1-ol;3-hydroxyprop-2-enoic acid.
What is the SMILES notation for 2-ethylhexan-1-ol;3-hydroxyprop-2-enoic acid?
The canonical SMILES for 2-ethylhexan-1-ol;3-hydroxyprop-2-enoic acid is CCCCC(CC)CO.O=C(O)C=CO.
What is the InChIKey of 2-ethylhexan-1-ol;3-hydroxyprop-2-enoic acid?
The InChIKey is CAUPDAWXPOMRJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O.C3H4O3/c1-3-5-6-8(4-2)7-9;4-2-1-3(5)6/h8-9H,3-7H2,1-2H3;1-2,4H,(H,5,6).
What are the key properties of 2-ethylhexan-1-ol;3-hydroxyprop-2-enoic acid?
2-ethylhexan-1-ol;3-hydroxyprop-2-enoic acid has a molecular weight of 218.29 g/mol, XLogP of 2.34, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexan-1-ol;3-hydroxyprop-2-enoic acid is sourced from PubChem (CID 174892129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).