C10H22O4 — CID 175223749
acetic acid;2-ethylhexane-1,6-diol (PubChem CID 175223749) has the molecular formula C10H22O4 and a molecular weight of 206.28 g/mol. Its IUPAC name is acetic acid;2-ethylhexane-1,6-diol.
| Compound Name | acetic acid;2-ethylhexane-1,6-diol |
|---|---|
| PubChem CID | 175223749 |
| Molecular Formula | C10H22O4 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | acetic acid;2-ethylhexane-1,6-diol |
| SMILES | CC(=O)O.CCC(CO)CCCCO |
| InChI | InChI=1S/C8H18O2.C2H4O2/c1-2-8(7-10)5-3-4-6-9;1-2(3)4/h8-10H,2-7H2,1H3;1H3,(H,3,4) |
| InChIKey | SWXNXPPBRRADDG-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|